C19H19F4NO2 — CID 126589009
2-[2-[(4-ethyl-2-fluorophenoxy)methyl]-3-(trifluoromethyl)phenyl]-N-methylacetamide (PubChem CID 126589009) has the molecular formula C19H19F4NO2 and a molecular weight of 369.36 g/mol. Its IUPAC name is 2-[2-[(4-ethyl-2-fluorophenoxy)methyl]-3-(trifluoromethyl)phenyl]-N-methylacetamide.
| Compound Name | 2-[2-[(4-ethyl-2-fluorophenoxy)methyl]-3-(trifluoromethyl)phenyl]-N-methylacetamide |
|---|---|
| PubChem CID | 126589009 |
| Molecular Formula | C19H19F4NO2 |
| Molecular Weight | 369.36 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 2-[2-[(4-ethyl-2-fluorophenoxy)methyl]-3-(trifluoromethyl)phenyl]-N-methylacetamide |
| SMILES | CCc1ccc(OCc2c(CC(=O)NC)cccc2C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C19H19F4NO2/c1-3-12-7-8-17(16(20)9-12)26-11-14-13(10-18(25)24-2)5-4-6-15(14)19(21,22)23/h4-9H,3,10-11H2,1-2H3,(H,24,25) |
| InChIKey | NNDOIANWXHAQAR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.36 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |