C24H27N5O2 — CID 123325684
1-[3-cyclopropyl-2-[[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylideneamino]oxymethyl]phenyl]-4-methyltetrazol-5-one (PubChem CID 123325684) has the molecular formula C24H27N5O2 and a molecular weight of 417.51 g/mol. Its IUPAC name is 1-[3-cyclopropyl-2-[[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylideneamino]oxymethyl]phenyl]-4-methyltetrazol-5-one.
| Compound Name | 1-[3-cyclopropyl-2-[[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylideneamino]oxymethyl]phenyl]-4-methyltetrazol-5-one |
|---|---|
| PubChem CID | 123325684 |
| Molecular Formula | C24H27N5O2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 1-[3-cyclopropyl-2-[[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylideneamino]oxymethyl]phenyl]-4-methyltetrazol-5-one |
| SMILES | CC(=NOCc1c(C2CC2)cccc1-n1nnn(C)c1=O)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C24H27N5O2/c1-16(19-13-10-17-6-3-4-7-20(17)14-19)25-31-15-22-21(18-11-12-18)8-5-9-23(22)29-24(30)28(2)26-27-29/h5,8-10,13-14,18H,3-4,6-7,11-12,15H2,1-2H3 |
| InChIKey | MYUWOZDQEBVWTQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|