C21H22BrN5O2 — CID 118451352
1-[2-[(E)-1-aminooxy-2-(5,6,7,8-tetrahydronaphthalen-2-yl)prop-1-enyl]-3-bromophenyl]-4-methyltetrazol-5-one (PubChem CID 118451352) has the molecular formula C21H22BrN5O2 and a molecular weight of 456.34 g/mol. Its IUPAC name is 1-[2-[(E)-1-aminooxy-2-(5,6,7,8-tetrahydronaphthalen-2-yl)prop-1-enyl]-3-bromophenyl]-4-methyltetrazol-5-one.
| Compound Name | 1-[2-[(E)-1-aminooxy-2-(5,6,7,8-tetrahydronaphthalen-2-yl)prop-1-enyl]-3-bromophenyl]-4-methyltetrazol-5-one |
|---|---|
| PubChem CID | 118451352 |
| Molecular Formula | C21H22BrN5O2 |
| Molecular Weight | 456.34 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | 1-[2-[(E)-1-aminooxy-2-(5,6,7,8-tetrahydronaphthalen-2-yl)prop-1-enyl]-3-bromophenyl]-4-methyltetrazol-5-one |
| SMILES | C/C(=C(\ON)c1c(Br)cccc1-n1nnn(C)c1=O)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C21H22BrN5O2/c1-13(15-11-10-14-6-3-4-7-16(14)12-15)20(29-23)19-17(22)8-5-9-18(19)27-21(28)26(2)24-25-27/h5,8-12H,3-4,6-7,23H2,1-2H3/b20-13+ |
| InChIKey | OFHYCMKCPQXOQT-DEDYPNTBSA-N |
| XLogP | 3.39 |
| TPSA | 87.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|