C22H25N5O2 — CID 118451365
1-[2-[(E)-1-aminooxy-2-(2,3-dihydro-1H-inden-4-yl)prop-1-enyl]-3-ethylphenyl]-4-methyltetrazol-5-one (PubChem CID 118451365) has the molecular formula C22H25N5O2 and a molecular weight of 391.48 g/mol. Its IUPAC name is 1-[2-[(E)-1-aminooxy-2-(2,3-dihydro-1H-inden-4-yl)prop-1-enyl]-3-ethylphenyl]-4-methyltetrazol-5-one.
| Compound Name | 1-[2-[(E)-1-aminooxy-2-(2,3-dihydro-1H-inden-4-yl)prop-1-enyl]-3-ethylphenyl]-4-methyltetrazol-5-one |
|---|---|
| PubChem CID | 118451365 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 1-[2-[(E)-1-aminooxy-2-(2,3-dihydro-1H-inden-4-yl)prop-1-enyl]-3-ethylphenyl]-4-methyltetrazol-5-one |
| SMILES | CCc1cccc(-n2nnn(C)c2=O)c1/C(ON)=C(/C)c1cccc2c1CCC2 |
| InChI | InChI=1S/C22H25N5O2/c1-4-15-8-7-13-19(27-22(28)26(3)24-25-27)20(15)21(29-23)14(2)17-11-5-9-16-10-6-12-18(16)17/h5,7-9,11,13H,4,6,10,12,23H2,1-3H3/b21-14+ |
| InChIKey | BVIPZXJBZXDJCU-KGENOOAVSA-N |
| XLogP | 2.80 |
| TPSA | 87.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|