C20H20ClN5O2 — CID 118451363
1-[2-[(E)-1-aminooxy-2-(3-chlorophenyl)prop-1-enyl]-3-cyclopropylphenyl]-4-methyltetrazol-5-one (PubChem CID 118451363) has the molecular formula C20H20ClN5O2 and a molecular weight of 397.87 g/mol. Its IUPAC name is 1-[2-[(E)-1-aminooxy-2-(3-chlorophenyl)prop-1-enyl]-3-cyclopropylphenyl]-4-methyltetrazol-5-one.
| Compound Name | 1-[2-[(E)-1-aminooxy-2-(3-chlorophenyl)prop-1-enyl]-3-cyclopropylphenyl]-4-methyltetrazol-5-one |
|---|---|
| PubChem CID | 118451363 |
| Molecular Formula | C20H20ClN5O2 |
| Molecular Weight | 397.87 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 1-[2-[(E)-1-aminooxy-2-(3-chlorophenyl)prop-1-enyl]-3-cyclopropylphenyl]-4-methyltetrazol-5-one |
| SMILES | C/C(=C(\ON)c1c(C2CC2)cccc1-n1nnn(C)c1=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H20ClN5O2/c1-12(14-5-3-6-15(21)11-14)19(28-22)18-16(13-9-10-13)7-4-8-17(18)26-20(27)25(2)23-24-26/h3-8,11,13H,9-10,22H2,1-2H3/b19-12+ |
| InChIKey | JAMSZXUUSNXQTD-XDHOZWIPSA-N |
| XLogP | 3.28 |
| TPSA | 87.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.87 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|