C18H17Cl2N5O3 — CID 118451370
1-[2-[(E)-1-aminooxy-2-(3,5-dichlorophenyl)prop-1-enyl]-3-methoxyphenyl]-4-methyltetrazol-5-one (PubChem CID 118451370) has the molecular formula C18H17Cl2N5O3 and a molecular weight of 422.27 g/mol. Its IUPAC name is 1-[2-[(E)-1-aminooxy-2-(3,5-dichlorophenyl)prop-1-enyl]-3-methoxyphenyl]-4-methyltetrazol-5-one.
| Compound Name | 1-[2-[(E)-1-aminooxy-2-(3,5-dichlorophenyl)prop-1-enyl]-3-methoxyphenyl]-4-methyltetrazol-5-one |
|---|---|
| PubChem CID | 118451370 |
| Molecular Formula | C18H17Cl2N5O3 |
| Molecular Weight | 422.27 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | 1-[2-[(E)-1-aminooxy-2-(3,5-dichlorophenyl)prop-1-enyl]-3-methoxyphenyl]-4-methyltetrazol-5-one |
| SMILES | COc1cccc(-n2nnn(C)c2=O)c1/C(ON)=C(/C)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H17Cl2N5O3/c1-10(11-7-12(19)9-13(20)8-11)17(28-21)16-14(5-4-6-15(16)27-3)25-18(26)24(2)22-23-25/h4-9H,21H2,1-3H3/b17-10+ |
| InChIKey | MGXGDROKLRPSSU-LICLKQGHSA-N |
| XLogP | 3.06 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.27 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|