C19H21N5O3 — CID 118411759
1-[2-[(E)-1-aminooxy-2-(2-methoxyphenyl)prop-1-enyl]-3-methylphenyl]-4-methyltetrazol-5-one (PubChem CID 118411759) has the molecular formula C19H21N5O3 and a molecular weight of 367.41 g/mol. Its IUPAC name is 1-[2-[(E)-1-aminooxy-2-(2-methoxyphenyl)prop-1-enyl]-3-methylphenyl]-4-methyltetrazol-5-one.
| Compound Name | 1-[2-[(E)-1-aminooxy-2-(2-methoxyphenyl)prop-1-enyl]-3-methylphenyl]-4-methyltetrazol-5-one |
|---|---|
| PubChem CID | 118411759 |
| Molecular Formula | C19H21N5O3 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 1-[2-[(E)-1-aminooxy-2-(2-methoxyphenyl)prop-1-enyl]-3-methylphenyl]-4-methyltetrazol-5-one |
| SMILES | COc1ccccc1/C(C)=C(/ON)c1c(C)cccc1-n1nnn(C)c1=O |
| InChI | InChI=1S/C19H21N5O3/c1-12-8-7-10-15(24-19(25)23(3)21-22-24)17(12)18(27-20)13(2)14-9-5-6-11-16(14)26-4/h5-11H,20H2,1-4H3/b18-13+ |
| InChIKey | GFDDEYCZVKFFJF-QGOAFFKASA-N |
| XLogP | 2.06 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|