C19H32N6O — CID 144635497
2-[[1-[(3S)-2,3-dimethyl-3,4-dihydropyrazol-5-yl]ethylideneamino]oxymethyl]-N,3-dimethylaniline;1-ethenyl-1-methylhydrazine (PubChem CID 144635497) has the molecular formula C19H32N6O and a molecular weight of 360.51 g/mol. Its IUPAC name is 2-[[1-[(3S)-2,3-dimethyl-3,4-dihydropyrazol-5-yl]ethylideneamino]oxymethyl]-N,3-dimethylaniline;1-ethenyl-1-methylhydrazine.
| Compound Name | 2-[[1-[(3S)-2,3-dimethyl-3,4-dihydropyrazol-5-yl]ethylideneamino]oxymethyl]-N,3-dimethylaniline;1-ethenyl-1-methylhydrazine |
|---|---|
| PubChem CID | 144635497 |
| Molecular Formula | C19H32N6O |
| Molecular Weight | 360.51 g/mol |
| Exact Mass | 360.26 |
| IUPAC Name | 2-[[1-[(3S)-2,3-dimethyl-3,4-dihydropyrazol-5-yl]ethylideneamino]oxymethyl]-N,3-dimethylaniline;1-ethenyl-1-methylhydrazine |
| SMILES | C=CN(C)N.CNc1cccc(C)c1CON=C(C)C1=NN(C)[C@@H](C)C1 |
| InChI | InChI=1S/C16H24N4O.C3H8N2/c1-11-7-6-8-15(17-4)14(11)10-21-19-13(3)16-9-12(2)20(5)18-16;1-3-5(2)4/h6-8,12,17H,9-10H2,1-5H3;3H,1,4H2,2H3/t12-;/m0./s1 |
| InChIKey | ODYUFENWDHYJPX-YDALLXLXSA-N |
| XLogP | 2.94 |
| TPSA | 78.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.51 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|