C17H23N3O3 — CID 144784892
formohydrazide;3-methyl-4-[[2-methyl-6-(methylamino)phenyl]methoxy]phenol (PubChem CID 144784892) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is formohydrazide;3-methyl-4-[[2-methyl-6-(methylamino)phenyl]methoxy]phenol.
| Compound Name | formohydrazide;3-methyl-4-[[2-methyl-6-(methylamino)phenyl]methoxy]phenol |
|---|---|
| PubChem CID | 144784892 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | formohydrazide;3-methyl-4-[[2-methyl-6-(methylamino)phenyl]methoxy]phenol |
| SMILES | CNc1cccc(C)c1COc1ccc(O)cc1C.NNC=O |
| InChI | InChI=1S/C16H19NO2.CH4N2O/c1-11-5-4-6-15(17-3)14(11)10-19-16-8-7-13(18)9-12(16)2;2-3-1-4/h4-9,17-18H,10H2,1-3H3;1H,2H2,(H,3,4) |
| InChIKey | KJXGMAXBEHTMBM-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|