C16H21BrN4O2 — CID 144784046
3-bromo-2-[(3,6-dimethyl-2-pyridinyl)oxymethyl]-N-methylaniline;formohydrazide (PubChem CID 144784046) has the molecular formula C16H21BrN4O2 and a molecular weight of 381.27 g/mol. Its IUPAC name is 3-bromo-2-[(3,6-dimethyl-2-pyridinyl)oxymethyl]-N-methylaniline;formohydrazide.
| Compound Name | 3-bromo-2-[(3,6-dimethyl-2-pyridinyl)oxymethyl]-N-methylaniline;formohydrazide |
|---|---|
| PubChem CID | 144784046 |
| Molecular Formula | C16H21BrN4O2 |
| Molecular Weight | 381.27 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 3-bromo-2-[(3,6-dimethyl-2-pyridinyl)oxymethyl]-N-methylaniline;formohydrazide |
| SMILES | CNc1cccc(Br)c1COc1nc(C)ccc1C.NNC=O |
| InChI | InChI=1S/C15H17BrN2O.CH4N2O/c1-10-7-8-11(2)18-15(10)19-9-12-13(16)5-4-6-14(12)17-3;2-3-1-4/h4-8,17H,9H2,1-3H3;1H,2H2,(H,3,4) |
| InChIKey | ODTCJZXMCQQPTL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.27 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|