C18H27ClN4O2 — CID 144784090
3-chloro-2-[(3,6-dimethyl-2-pyridinyl)oxymethyl]-N-methylaniline;ethane;formohydrazide (PubChem CID 144784090) has the molecular formula C18H27ClN4O2 and a molecular weight of 366.89 g/mol. Its IUPAC name is 3-chloro-2-[(3,6-dimethyl-2-pyridinyl)oxymethyl]-N-methylaniline;ethane;formohydrazide.
| Compound Name | 3-chloro-2-[(3,6-dimethyl-2-pyridinyl)oxymethyl]-N-methylaniline;ethane;formohydrazide |
|---|---|
| PubChem CID | 144784090 |
| Molecular Formula | C18H27ClN4O2 |
| Molecular Weight | 366.89 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 3-chloro-2-[(3,6-dimethyl-2-pyridinyl)oxymethyl]-N-methylaniline;ethane;formohydrazide |
| SMILES | CC.CNc1cccc(Cl)c1COc1nc(C)ccc1C.NNC=O |
| InChI | InChI=1S/C15H17ClN2O.C2H6.CH4N2O/c1-10-7-8-11(2)18-15(10)19-9-12-13(16)5-4-6-14(12)17-3;1-2;2-3-1-4/h4-8,17H,9H2,1-3H3;1-2H3;1H,2H2,(H,3,4) |
| InChIKey | ILYDGVCJYUOPRX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.89 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|