C22H29ClN4O2S — CID 144799641
3-chloro-2-[[4-[(Z)-2-ethylsulfanyl-1-(methylideneamino)prop-1-enyl]-2-methylphenoxy]methyl]-N-methylaniline;formohydrazide (PubChem CID 144799641) has the molecular formula C22H29ClN4O2S and a molecular weight of 449.02 g/mol. Its IUPAC name is 3-chloro-2-[[4-[(Z)-2-ethylsulfanyl-1-(methylideneamino)prop-1-enyl]-2-methylphenoxy]methyl]-N-methylaniline;formohydrazide.
| Compound Name | 3-chloro-2-[[4-[(Z)-2-ethylsulfanyl-1-(methylideneamino)prop-1-enyl]-2-methylphenoxy]methyl]-N-methylaniline;formohydrazide |
|---|---|
| PubChem CID | 144799641 |
| Molecular Formula | C22H29ClN4O2S |
| Molecular Weight | 449.02 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 3-chloro-2-[[4-[(Z)-2-ethylsulfanyl-1-(methylideneamino)prop-1-enyl]-2-methylphenoxy]methyl]-N-methylaniline;formohydrazide |
| SMILES | C=N/C(=C(/C)SCC)c1ccc(OCc2c(Cl)cccc2NC)c(C)c1.NNC=O |
| InChI | InChI=1S/C21H25ClN2OS.CH4N2O/c1-6-26-15(3)21(24-5)16-10-11-20(14(2)12-16)25-13-17-18(22)8-7-9-19(17)23-4;2-3-1-4/h7-12,23H,5-6,13H2,1-4H3;1H,2H2,(H,3,4)/b21-15-; |
| InChIKey | ZQLPFUZMRKQKLD-XGRJIHFXSA-N |
| XLogP | 5.02 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.02 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|