C17H18ClF2NO2 — CID 144933012
3-chloro-2-[(2,4-difluorophenoxy)methyl]-N-methylaniline;propanal (PubChem CID 144933012) has the molecular formula C17H18ClF2NO2 and a molecular weight of 341.79 g/mol. Its IUPAC name is 3-chloro-2-[(2,4-difluorophenoxy)methyl]-N-methylaniline;propanal.
| Compound Name | 3-chloro-2-[(2,4-difluorophenoxy)methyl]-N-methylaniline;propanal |
|---|---|
| PubChem CID | 144933012 |
| Molecular Formula | C17H18ClF2NO2 |
| Molecular Weight | 341.79 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 3-chloro-2-[(2,4-difluorophenoxy)methyl]-N-methylaniline;propanal |
| SMILES | CCC=O.CNc1cccc(Cl)c1COc1ccc(F)cc1F |
| InChI | InChI=1S/C14H12ClF2NO.C3H6O/c1-18-13-4-2-3-11(15)10(13)8-19-14-6-5-9(16)7-12(14)17;1-2-3-4/h2-7,18H,8H2,1H3;3H,2H2,1H3 |
| InChIKey | LHFZLXXZAWSCLU-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.79 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|