C25H33N3O2 — CID 144659539
cyclopropyl-[4-[[2-cyclopropyl-6-(methylamino)phenyl]methoxy]-3-methylphenyl]methanone;1-ethenyl-1-methylhydrazine (PubChem CID 144659539) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is cyclopropyl-[4-[[2-cyclopropyl-6-(methylamino)phenyl]methoxy]-3-methylphenyl]methanone;1-ethenyl-1-methylhydrazine.
| Compound Name | cyclopropyl-[4-[[2-cyclopropyl-6-(methylamino)phenyl]methoxy]-3-methylphenyl]methanone;1-ethenyl-1-methylhydrazine |
|---|---|
| PubChem CID | 144659539 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | cyclopropyl-[4-[[2-cyclopropyl-6-(methylamino)phenyl]methoxy]-3-methylphenyl]methanone;1-ethenyl-1-methylhydrazine |
| SMILES | C=CN(C)N.CNc1cccc(C2CC2)c1COc1ccc(C(=O)C2CC2)cc1C |
| InChI | InChI=1S/C22H25NO2.C3H8N2/c1-14-12-17(22(24)16-8-9-16)10-11-21(14)25-13-19-18(15-6-7-15)4-3-5-20(19)23-2;1-3-5(2)4/h3-5,10-12,15-16,23H,6-9,13H2,1-2H3;3H,1,4H2,2H3 |
| InChIKey | BCHDXGMETVPJMR-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|