C18H26BrN3O2 — CID 144838544
3-bromo-2-[(2-ethylphenyl)methoxy]-N-methylaniline;formohydrazide;methane (PubChem CID 144838544) has the molecular formula C18H26BrN3O2 and a molecular weight of 396.33 g/mol. Its IUPAC name is 3-bromo-2-[(2-ethylphenyl)methoxy]-N-methylaniline;formohydrazide;methane.
| Compound Name | 3-bromo-2-[(2-ethylphenyl)methoxy]-N-methylaniline;formohydrazide;methane |
|---|---|
| PubChem CID | 144838544 |
| Molecular Formula | C18H26BrN3O2 |
| Molecular Weight | 396.33 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 3-bromo-2-[(2-ethylphenyl)methoxy]-N-methylaniline;formohydrazide;methane |
| SMILES | C.CCc1ccccc1COc1c(Br)cccc1NC.NNC=O |
| InChI | InChI=1S/C16H18BrNO.CH4N2O.CH4/c1-3-12-7-4-5-8-13(12)11-19-16-14(17)9-6-10-15(16)18-2;2-3-1-4;/h4-10,18H,3,11H2,1-2H3;1H,2H2,(H,3,4);1H4 |
| InChIKey | BXTWGCKNXOTYCB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.33 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|