C20H27NO2 — CID 144932555
2-[(2-ethyl-5-methylphenoxy)methyl]-N-methylaniline;propanal (PubChem CID 144932555) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is 2-[(2-ethyl-5-methylphenoxy)methyl]-N-methylaniline;propanal.
| Compound Name | 2-[(2-ethyl-5-methylphenoxy)methyl]-N-methylaniline;propanal |
|---|---|
| PubChem CID | 144932555 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 2-[(2-ethyl-5-methylphenoxy)methyl]-N-methylaniline;propanal |
| SMILES | CCC=O.CCc1ccc(C)cc1OCc1ccccc1NC |
| InChI | InChI=1S/C17H21NO.C3H6O/c1-4-14-10-9-13(2)11-17(14)19-12-15-7-5-6-8-16(15)18-3;1-2-3-4/h5-11,18H,4,12H2,1-3H3;3H,2H2,1H3 |
| InChIKey | ZHUPWROWLDYRPW-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|