C22H33NO2 — CID 144933057
ethane;5-ethyl-N-methyl-2-[(2-methylphenoxy)methyl]aniline;propanal (PubChem CID 144933057) has the molecular formula C22H33NO2 and a molecular weight of 343.51 g/mol. Its IUPAC name is ethane;5-ethyl-N-methyl-2-[(2-methylphenoxy)methyl]aniline;propanal.
| Compound Name | ethane;5-ethyl-N-methyl-2-[(2-methylphenoxy)methyl]aniline;propanal |
|---|---|
| PubChem CID | 144933057 |
| Molecular Formula | C22H33NO2 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | ethane;5-ethyl-N-methyl-2-[(2-methylphenoxy)methyl]aniline;propanal |
| SMILES | CC.CCC=O.CCc1ccc(COc2ccccc2C)c(NC)c1 |
| InChI | InChI=1S/C17H21NO.C3H6O.C2H6/c1-4-14-9-10-15(16(11-14)18-3)12-19-17-8-6-5-7-13(17)2;1-2-3-4;1-2/h5-11,18H,4,12H2,1-3H3;3H,2H2,1H3;1-2H3 |
| InChIKey | IYACSDAXGWZMKW-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|