C18H18N2OS — CID 94758930
2-[(4-methylphenyl)methoxy]-5-(4-methyl-1,3-thiazol-2-yl)aniline (PubChem CID 94758930) has the molecular formula C18H18N2OS and a molecular weight of 310.42 g/mol. Its IUPAC name is 2-[(4-methylphenyl)methoxy]-5-(4-methyl-1,3-thiazol-2-yl)aniline.
| Compound Name | 2-[(4-methylphenyl)methoxy]-5-(4-methyl-1,3-thiazol-2-yl)aniline |
|---|---|
| PubChem CID | 94758930 |
| Molecular Formula | C18H18N2OS |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 2-[(4-methylphenyl)methoxy]-5-(4-methyl-1,3-thiazol-2-yl)aniline |
| SMILES | Cc1ccc(COc2ccc(-c3nc(C)cs3)cc2N)cc1 |
| InChI | InChI=1S/C18H18N2OS/c1-12-3-5-14(6-4-12)10-21-17-8-7-15(9-16(17)19)18-20-13(2)11-22-18/h3-9,11H,10,19H2,1-2H3 |
| InChIKey | GQBOCUVBUNCPMZ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|