C23H23F3N4O2 — CID 144773041
1-amino-3-[2-[[4-(6-ethyl-2-pyridinyl)-2-(trifluoromethyl)phenoxy]methyl]-3-methylphenyl]urea (PubChem CID 144773041) has the molecular formula C23H23F3N4O2 and a molecular weight of 444.46 g/mol. Its IUPAC name is 1-amino-3-[2-[[4-(6-ethyl-2-pyridinyl)-2-(trifluoromethyl)phenoxy]methyl]-3-methylphenyl]urea.
| Compound Name | 1-amino-3-[2-[[4-(6-ethyl-2-pyridinyl)-2-(trifluoromethyl)phenoxy]methyl]-3-methylphenyl]urea |
|---|---|
| PubChem CID | 144773041 |
| Molecular Formula | C23H23F3N4O2 |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 1-amino-3-[2-[[4-(6-ethyl-2-pyridinyl)-2-(trifluoromethyl)phenoxy]methyl]-3-methylphenyl]urea |
| SMILES | CCc1cccc(-c2ccc(OCc3c(C)cccc3NC(=O)NN)c(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C23H23F3N4O2/c1-3-16-7-5-8-19(28-16)15-10-11-21(18(12-15)23(24,25)26)32-13-17-14(2)6-4-9-20(17)29-22(31)30-27/h4-12H,3,13,27H2,1-2H3,(H2,29,30,31) |
| InChIKey | YHHMNDOZNBPJHQ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|