C18H17F4NO2 — CID 129038628
N-[3-fluoro-2-[[4-methyl-2-(trifluoromethyl)phenoxy]methyl]phenyl]propanamide (PubChem CID 129038628) has the molecular formula C18H17F4NO2 and a molecular weight of 355.33 g/mol. Its IUPAC name is N-[3-fluoro-2-[[4-methyl-2-(trifluoromethyl)phenoxy]methyl]phenyl]propanamide.
| Compound Name | N-[3-fluoro-2-[[4-methyl-2-(trifluoromethyl)phenoxy]methyl]phenyl]propanamide |
|---|---|
| PubChem CID | 129038628 |
| Molecular Formula | C18H17F4NO2 |
| Molecular Weight | 355.33 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | N-[3-fluoro-2-[[4-methyl-2-(trifluoromethyl)phenoxy]methyl]phenyl]propanamide |
| SMILES | CCC(=O)Nc1cccc(F)c1COc1ccc(C)cc1C(F)(F)F |
| InChI | InChI=1S/C18H17F4NO2/c1-3-17(24)23-15-6-4-5-14(19)12(15)10-25-16-8-7-11(2)9-13(16)18(20,21)22/h4-9H,3,10H2,1-2H3,(H,23,24) |
| InChIKey | QTSPUEGGYSSRQX-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.33 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |