C18H20FNO2S — CID 129038608
O-ethyl N-[2-[(2,4-dimethylphenoxy)methyl]-3-fluorophenyl]carbamothioate (PubChem CID 129038608) has the molecular formula C18H20FNO2S and a molecular weight of 333.43 g/mol. Its IUPAC name is O-ethyl N-[2-[(2,4-dimethylphenoxy)methyl]-3-fluorophenyl]carbamothioate.
| Compound Name | O-ethyl N-[2-[(2,4-dimethylphenoxy)methyl]-3-fluorophenyl]carbamothioate |
|---|---|
| PubChem CID | 129038608 |
| Molecular Formula | C18H20FNO2S |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | O-ethyl N-[2-[(2,4-dimethylphenoxy)methyl]-3-fluorophenyl]carbamothioate |
| SMILES | CCOC(=S)Nc1cccc(F)c1COc1ccc(C)cc1C |
| InChI | InChI=1S/C18H20FNO2S/c1-4-21-18(23)20-16-7-5-6-15(19)14(16)11-22-17-9-8-12(2)10-13(17)3/h5-10H,4,11H2,1-3H3,(H,20,23) |
| InChIKey | QTJTYALJIJVIFE-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|