C20H23F2NO3 — CID 126588372
methyl N-[2-[[2-(difluoromethyl)-4-ethylphenoxy]methyl]-3-ethylphenyl]carbamate (PubChem CID 126588372) has the molecular formula C20H23F2NO3 and a molecular weight of 363.40 g/mol. Its IUPAC name is methyl N-[2-[[2-(difluoromethyl)-4-ethylphenoxy]methyl]-3-ethylphenyl]carbamate.
| Compound Name | methyl N-[2-[[2-(difluoromethyl)-4-ethylphenoxy]methyl]-3-ethylphenyl]carbamate |
|---|---|
| PubChem CID | 126588372 |
| Molecular Formula | C20H23F2NO3 |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | methyl N-[2-[[2-(difluoromethyl)-4-ethylphenoxy]methyl]-3-ethylphenyl]carbamate |
| SMILES | CCc1ccc(OCc2c(CC)cccc2NC(=O)OC)c(C(F)F)c1 |
| InChI | InChI=1S/C20H23F2NO3/c1-4-13-9-10-18(15(11-13)19(21)22)26-12-16-14(5-2)7-6-8-17(16)23-20(24)25-3/h6-11,19H,4-5,12H2,1-3H3,(H,23,24) |
| InChIKey | USOQAPCBYSBMRE-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |