C20H21F4NO2 — CID 126588884
N-[3-(difluoromethyl)-2-[[2-(difluoromethyl)-4-ethylphenoxy]methyl]phenyl]propanamide (PubChem CID 126588884) has the molecular formula C20H21F4NO2 and a molecular weight of 383.39 g/mol. Its IUPAC name is N-[3-(difluoromethyl)-2-[[2-(difluoromethyl)-4-ethylphenoxy]methyl]phenyl]propanamide.
| Compound Name | N-[3-(difluoromethyl)-2-[[2-(difluoromethyl)-4-ethylphenoxy]methyl]phenyl]propanamide |
|---|---|
| PubChem CID | 126588884 |
| Molecular Formula | C20H21F4NO2 |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | N-[3-(difluoromethyl)-2-[[2-(difluoromethyl)-4-ethylphenoxy]methyl]phenyl]propanamide |
| SMILES | CCC(=O)Nc1cccc(C(F)F)c1COc1ccc(CC)cc1C(F)F |
| InChI | InChI=1S/C20H21F4NO2/c1-3-12-8-9-17(14(10-12)20(23)24)27-11-15-13(19(21)22)6-5-7-16(15)25-18(26)4-2/h5-10,19-20H,3-4,11H2,1-2H3,(H,25,26) |
| InChIKey | WOMMPOPAPOTBOH-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |