C19H21F2NO2S — CID 126587855
S-methyl N-[3-(difluoromethyl)-2-[(4-ethyl-2-methylphenoxy)methyl]phenyl]carbamothioate (PubChem CID 126587855) has the molecular formula C19H21F2NO2S and a molecular weight of 365.45 g/mol. Its IUPAC name is S-methyl N-[3-(difluoromethyl)-2-[(4-ethyl-2-methylphenoxy)methyl]phenyl]carbamothioate.
| Compound Name | S-methyl N-[3-(difluoromethyl)-2-[(4-ethyl-2-methylphenoxy)methyl]phenyl]carbamothioate |
|---|---|
| PubChem CID | 126587855 |
| Molecular Formula | C19H21F2NO2S |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | S-methyl N-[3-(difluoromethyl)-2-[(4-ethyl-2-methylphenoxy)methyl]phenyl]carbamothioate |
| SMILES | CCc1ccc(OCc2c(NC(=O)SC)cccc2C(F)F)c(C)c1 |
| InChI | InChI=1S/C19H21F2NO2S/c1-4-13-8-9-17(12(2)10-13)24-11-15-14(18(20)21)6-5-7-16(15)22-19(23)25-3/h5-10,18H,4,11H2,1-3H3,(H,22,23) |
| InChIKey | CVOBGNSMRUQBIP-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|