C20H24O2S2 — CID 122646374
O-[3-(sulfanylmethyl)-2-[(2,4,5-trimethylphenoxy)methyl]phenyl] propanethioate (PubChem CID 122646374) has the molecular formula C20H24O2S2 and a molecular weight of 360.54 g/mol. Its IUPAC name is O-[3-(sulfanylmethyl)-2-[(2,4,5-trimethylphenoxy)methyl]phenyl] propanethioate.
| Compound Name | O-[3-(sulfanylmethyl)-2-[(2,4,5-trimethylphenoxy)methyl]phenyl] propanethioate |
|---|---|
| PubChem CID | 122646374 |
| Molecular Formula | C20H24O2S2 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | O-[3-(sulfanylmethyl)-2-[(2,4,5-trimethylphenoxy)methyl]phenyl] propanethioate |
| SMILES | CCC(=S)Oc1cccc(CS)c1COc1cc(C)c(C)cc1C |
| InChI | InChI=1S/C20H24O2S2/c1-5-20(24)22-18-8-6-7-16(12-23)17(18)11-21-19-10-14(3)13(2)9-15(19)4/h6-10,23H,5,11-12H2,1-4H3 |
| InChIKey | OVNHABVFGDCYRS-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|