C20H24O4S — CID 122646281
[3-ethoxy-2-[(2,4,5-trimethylphenoxy)methyl]phenoxy]-methoxymethanethione (PubChem CID 122646281) has the molecular formula C20H24O4S and a molecular weight of 360.48 g/mol. Its IUPAC name is [3-ethoxy-2-[(2,4,5-trimethylphenoxy)methyl]phenoxy]-methoxymethanethione.
| Compound Name | [3-ethoxy-2-[(2,4,5-trimethylphenoxy)methyl]phenoxy]-methoxymethanethione |
|---|---|
| PubChem CID | 122646281 |
| Molecular Formula | C20H24O4S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | [3-ethoxy-2-[(2,4,5-trimethylphenoxy)methyl]phenoxy]-methoxymethanethione |
| SMILES | CCOc1cccc(OC(=S)OC)c1COc1cc(C)c(C)cc1C |
| InChI | InChI=1S/C20H24O4S/c1-6-22-17-8-7-9-18(24-20(25)21-5)16(17)12-23-19-11-14(3)13(2)10-15(19)4/h7-11H,6,12H2,1-5H3 |
| InChIKey | GGDLIQGKHKSTKB-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|