C18H20O2S — CID 122646248
O-[2-[(2,4-dimethylphenoxy)methyl]phenyl] propanethioate (PubChem CID 122646248) has the molecular formula C18H20O2S and a molecular weight of 300.42 g/mol. Its IUPAC name is O-[2-[(2,4-dimethylphenoxy)methyl]phenyl] propanethioate.
| Compound Name | O-[2-[(2,4-dimethylphenoxy)methyl]phenyl] propanethioate |
|---|---|
| PubChem CID | 122646248 |
| Molecular Formula | C18H20O2S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | O-[2-[(2,4-dimethylphenoxy)methyl]phenyl] propanethioate |
| SMILES | CCC(=S)Oc1ccccc1COc1ccc(C)cc1C |
| InChI | InChI=1S/C18H20O2S/c1-4-18(21)20-17-8-6-5-7-15(17)12-19-16-10-9-13(2)11-14(16)3/h5-11H,4,12H2,1-3H3 |
| InChIKey | DNWPSEGODMFAKE-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|