C15H16OS — CID 54329729
2-[(2,4-dimethylphenoxy)methyl]benzenethiol (PubChem CID 54329729) has the molecular formula C15H16OS and a molecular weight of 244.36 g/mol. Its IUPAC name is 2-[(2,4-dimethylphenoxy)methyl]benzenethiol.
| Compound Name | 2-[(2,4-dimethylphenoxy)methyl]benzenethiol |
|---|---|
| PubChem CID | 54329729 |
| Molecular Formula | C15H16OS |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 2-[(2,4-dimethylphenoxy)methyl]benzenethiol |
| SMILES | Cc1ccc(OCc2ccccc2S)c(C)c1 |
| InChI | InChI=1S/C15H16OS/c1-11-7-8-14(12(2)9-11)16-10-13-5-3-4-6-15(13)17/h3-9,17H,10H2,1-2H3 |
| InChIKey | SXMFSMGYYZWXER-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|