C19H19NO — CID 79232555
4-[(2,4-dimethylphenoxy)methyl]-2-methylquinoline (PubChem CID 79232555) has the molecular formula C19H19NO and a molecular weight of 277.37 g/mol. Its IUPAC name is 4-[(2,4-dimethylphenoxy)methyl]-2-methylquinoline.
| Compound Name | 4-[(2,4-dimethylphenoxy)methyl]-2-methylquinoline |
|---|---|
| PubChem CID | 79232555 |
| Molecular Formula | C19H19NO |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 4-[(2,4-dimethylphenoxy)methyl]-2-methylquinoline |
| SMILES | Cc1ccc(OCc2cc(C)nc3ccccc23)c(C)c1 |
| InChI | InChI=1S/C19H19NO/c1-13-8-9-19(14(2)10-13)21-12-16-11-15(3)20-18-7-5-4-6-17(16)18/h4-11H,12H2,1-3H3 |
| InChIKey | FQRKSKHORXZXAF-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |