C19H18O — CID 78906369
1-[(2,5-dimethylphenoxy)methyl]naphthalene (PubChem CID 78906369) has the molecular formula C19H18O and a molecular weight of 262.35 g/mol. Its IUPAC name is 1-[(2,5-dimethylphenoxy)methyl]naphthalene.
| Compound Name | 1-[(2,5-dimethylphenoxy)methyl]naphthalene |
|---|---|
| PubChem CID | 78906369 |
| Molecular Formula | C19H18O |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 1-[(2,5-dimethylphenoxy)methyl]naphthalene |
| SMILES | Cc1ccc(C)c(OCc2cccc3ccccc23)c1 |
| InChI | InChI=1S/C19H18O/c1-14-10-11-15(2)19(12-14)20-13-17-8-5-7-16-6-3-4-9-18(16)17/h3-12H,13H2,1-2H3 |
| InChIKey | YXRXGNAOGSKVLD-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |