C16H18FNO — CID 107114032
[3-[(2,5-dimethylphenoxy)methyl]-2-fluorophenyl]methanamine (PubChem CID 107114032) has the molecular formula C16H18FNO and a molecular weight of 259.32 g/mol. Its IUPAC name is [3-[(2,5-dimethylphenoxy)methyl]-2-fluorophenyl]methanamine.
| Compound Name | [3-[(2,5-dimethylphenoxy)methyl]-2-fluorophenyl]methanamine |
|---|---|
| PubChem CID | 107114032 |
| Molecular Formula | C16H18FNO |
| Molecular Weight | 259.32 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | [3-[(2,5-dimethylphenoxy)methyl]-2-fluorophenyl]methanamine |
| SMILES | Cc1ccc(C)c(OCc2cccc(CN)c2F)c1 |
| InChI | InChI=1S/C16H18FNO/c1-11-6-7-12(2)15(8-11)19-10-14-5-3-4-13(9-18)16(14)17/h3-8H,9-10,18H2,1-2H3 |
| InChIKey | RKGGPYOLPRKBFW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |