C15H18N2O — CID 114199212
[2-[(2,4-dimethylphenoxy)methyl]-3-pyridinyl]methanamine (PubChem CID 114199212) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is [2-[(2,4-dimethylphenoxy)methyl]-3-pyridinyl]methanamine.
| Compound Name | [2-[(2,4-dimethylphenoxy)methyl]-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 114199212 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | [2-[(2,4-dimethylphenoxy)methyl]-3-pyridinyl]methanamine |
| SMILES | Cc1ccc(OCc2ncccc2CN)c(C)c1 |
| InChI | InChI=1S/C15H18N2O/c1-11-5-6-15(12(2)8-11)18-10-14-13(9-16)4-3-7-17-14/h3-8H,9-10,16H2,1-2H3 |
| InChIKey | JSOGQWCHOVJVCY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |