C17H19NO2S — CID 122646189
O-[2-[(2,4-dimethylphenoxy)methyl]phenyl] N-methylcarbamothioate (PubChem CID 122646189) has the molecular formula C17H19NO2S and a molecular weight of 301.41 g/mol. Its IUPAC name is O-[2-[(2,4-dimethylphenoxy)methyl]phenyl] N-methylcarbamothioate.
| Compound Name | O-[2-[(2,4-dimethylphenoxy)methyl]phenyl] N-methylcarbamothioate |
|---|---|
| PubChem CID | 122646189 |
| Molecular Formula | C17H19NO2S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | O-[2-[(2,4-dimethylphenoxy)methyl]phenyl] N-methylcarbamothioate |
| SMILES | CNC(=S)Oc1ccccc1COc1ccc(C)cc1C |
| InChI | InChI=1S/C17H19NO2S/c1-12-8-9-15(13(2)10-12)19-11-14-6-4-5-7-16(14)20-17(21)18-3/h4-10H,11H2,1-3H3,(H,18,21) |
| InChIKey | SKXANODJFVYXFO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|