C17H19FN2O2 — CID 129039724
1-[2-[(2,4-dimethylphenoxy)methyl]-6-fluorophenyl]-3-methylurea (PubChem CID 129039724) has the molecular formula C17H19FN2O2 and a molecular weight of 302.35 g/mol. Its IUPAC name is 1-[2-[(2,4-dimethylphenoxy)methyl]-6-fluorophenyl]-3-methylurea.
| Compound Name | 1-[2-[(2,4-dimethylphenoxy)methyl]-6-fluorophenyl]-3-methylurea |
|---|---|
| PubChem CID | 129039724 |
| Molecular Formula | C17H19FN2O2 |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 1-[2-[(2,4-dimethylphenoxy)methyl]-6-fluorophenyl]-3-methylurea |
| SMILES | CNC(=O)Nc1c(F)cccc1COc1ccc(C)cc1C |
| InChI | InChI=1S/C17H19FN2O2/c1-11-7-8-15(12(2)9-11)22-10-13-5-4-6-14(18)16(13)20-17(21)19-3/h4-9H,10H2,1-3H3,(H2,19,20,21) |
| InChIKey | CINMQCZHRLZVOH-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |