C18H20O3S — CID 122646231
O-[2-[(2,4-dimethylphenoxy)methyl]-3-(hydroxymethyl)phenyl] ethanethioate (PubChem CID 122646231) has the molecular formula C18H20O3S and a molecular weight of 316.42 g/mol. Its IUPAC name is O-[2-[(2,4-dimethylphenoxy)methyl]-3-(hydroxymethyl)phenyl] ethanethioate.
| Compound Name | O-[2-[(2,4-dimethylphenoxy)methyl]-3-(hydroxymethyl)phenyl] ethanethioate |
|---|---|
| PubChem CID | 122646231 |
| Molecular Formula | C18H20O3S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | O-[2-[(2,4-dimethylphenoxy)methyl]-3-(hydroxymethyl)phenyl] ethanethioate |
| SMILES | CC(=S)Oc1cccc(CO)c1COc1ccc(C)cc1C |
| InChI | InChI=1S/C18H20O3S/c1-12-7-8-17(13(2)9-12)20-11-16-15(10-19)5-4-6-18(16)21-14(3)22/h4-9,19H,10-11H2,1-3H3 |
| InChIKey | AYPZBRYBQQZKFL-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|