C18H18F2O5 — CID 122645423
[2-[[2-(difluoromethyl)-4-methylphenoxy]methyl]-3-(hydroxymethyl)phenyl] methyl carbonate (PubChem CID 122645423) has the molecular formula C18H18F2O5 and a molecular weight of 352.33 g/mol. Its IUPAC name is [2-[[2-(difluoromethyl)-4-methylphenoxy]methyl]-3-(hydroxymethyl)phenyl] methyl carbonate.
| Compound Name | [2-[[2-(difluoromethyl)-4-methylphenoxy]methyl]-3-(hydroxymethyl)phenyl] methyl carbonate |
|---|---|
| PubChem CID | 122645423 |
| Molecular Formula | C18H18F2O5 |
| Molecular Weight | 352.33 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | [2-[[2-(difluoromethyl)-4-methylphenoxy]methyl]-3-(hydroxymethyl)phenyl] methyl carbonate |
| SMILES | COC(=O)Oc1cccc(CO)c1COc1ccc(C)cc1C(F)F |
| InChI | InChI=1S/C18H18F2O5/c1-11-6-7-15(13(8-11)17(19)20)24-10-14-12(9-21)4-3-5-16(14)25-18(22)23-2/h3-8,17,21H,9-10H2,1-2H3 |
| InChIKey | XDPUTTZLSBMJAY-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.33 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|