C19H23NO2S — CID 122649829
O-[2-[(4-ethyl-2-methylphenoxy)methyl]-3-methylphenyl] N-methylcarbamothioate (PubChem CID 122649829) has the molecular formula C19H23NO2S and a molecular weight of 329.47 g/mol. Its IUPAC name is O-[2-[(4-ethyl-2-methylphenoxy)methyl]-3-methylphenyl] N-methylcarbamothioate.
| Compound Name | O-[2-[(4-ethyl-2-methylphenoxy)methyl]-3-methylphenyl] N-methylcarbamothioate |
|---|---|
| PubChem CID | 122649829 |
| Molecular Formula | C19H23NO2S |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | O-[2-[(4-ethyl-2-methylphenoxy)methyl]-3-methylphenyl] N-methylcarbamothioate |
| SMILES | CCc1ccc(OCc2c(C)cccc2OC(=S)NC)c(C)c1 |
| InChI | InChI=1S/C19H23NO2S/c1-5-15-9-10-17(14(3)11-15)21-12-16-13(2)7-6-8-18(16)22-19(23)20-4/h6-11H,5,12H2,1-4H3,(H,20,23) |
| InChIKey | IONFYAFWGFEKOS-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|