C18H20BrNOS — CID 129039770
N-[4-bromo-2-[(2,4-dimethylphenoxy)methyl]phenyl]propanethioamide (PubChem CID 129039770) has the molecular formula C18H20BrNOS and a molecular weight of 378.34 g/mol. Its IUPAC name is N-[4-bromo-2-[(2,4-dimethylphenoxy)methyl]phenyl]propanethioamide.
| Compound Name | N-[4-bromo-2-[(2,4-dimethylphenoxy)methyl]phenyl]propanethioamide |
|---|---|
| PubChem CID | 129039770 |
| Molecular Formula | C18H20BrNOS |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | N-[4-bromo-2-[(2,4-dimethylphenoxy)methyl]phenyl]propanethioamide |
| SMILES | CCC(=S)Nc1ccc(Br)cc1COc1ccc(C)cc1C |
| InChI | InChI=1S/C18H20BrNOS/c1-4-18(22)20-16-7-6-15(19)10-14(16)11-21-17-8-5-12(2)9-13(17)3/h5-10H,4,11H2,1-3H3,(H,20,22) |
| InChIKey | OQZSJOLOCLSNOC-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|