C17H18BrNO2S — CID 129039729
S-methyl N-[4-bromo-2-[(2,4-dimethylphenoxy)methyl]phenyl]carbamothioate (PubChem CID 129039729) has the molecular formula C17H18BrNO2S and a molecular weight of 380.31 g/mol. Its IUPAC name is S-methyl N-[4-bromo-2-[(2,4-dimethylphenoxy)methyl]phenyl]carbamothioate.
| Compound Name | S-methyl N-[4-bromo-2-[(2,4-dimethylphenoxy)methyl]phenyl]carbamothioate |
|---|---|
| PubChem CID | 129039729 |
| Molecular Formula | C17H18BrNO2S |
| Molecular Weight | 380.31 g/mol |
| Exact Mass | 379.02 |
| IUPAC Name | S-methyl N-[4-bromo-2-[(2,4-dimethylphenoxy)methyl]phenyl]carbamothioate |
| SMILES | CSC(=O)Nc1ccc(Br)cc1COc1ccc(C)cc1C |
| InChI | InChI=1S/C17H18BrNO2S/c1-11-4-7-16(12(2)8-11)21-10-13-9-14(18)5-6-15(13)19-17(20)22-3/h4-9H,10H2,1-3H3,(H,19,20) |
| InChIKey | ZUBCRZOCDACVQT-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.31 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|