C17H18BrNO3 — CID 129039275
methyl N-[5-bromo-2-[(2,4-dimethylphenoxy)methyl]phenyl]carbamate (PubChem CID 129039275) has the molecular formula C17H18BrNO3 and a molecular weight of 364.24 g/mol. Its IUPAC name is methyl N-[5-bromo-2-[(2,4-dimethylphenoxy)methyl]phenyl]carbamate.
| Compound Name | methyl N-[5-bromo-2-[(2,4-dimethylphenoxy)methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 129039275 |
| Molecular Formula | C17H18BrNO3 |
| Molecular Weight | 364.24 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | methyl N-[5-bromo-2-[(2,4-dimethylphenoxy)methyl]phenyl]carbamate |
| SMILES | COC(=O)Nc1cc(Br)ccc1COc1ccc(C)cc1C |
| InChI | InChI=1S/C17H18BrNO3/c1-11-4-7-16(12(2)8-11)22-10-13-5-6-14(18)9-15(13)19-17(20)21-3/h4-9H,10H2,1-3H3,(H,19,20) |
| InChIKey | QMMRIERBUKTEAT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.24 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |