C21H25NOS — CID 129054357
N-[4-ethenyl-2-[(4-ethyl-2-methylphenoxy)methyl]phenyl]propanethioamide (PubChem CID 129054357) has the molecular formula C21H25NOS and a molecular weight of 339.50 g/mol. Its IUPAC name is N-[4-ethenyl-2-[(4-ethyl-2-methylphenoxy)methyl]phenyl]propanethioamide.
| Compound Name | N-[4-ethenyl-2-[(4-ethyl-2-methylphenoxy)methyl]phenyl]propanethioamide |
|---|---|
| PubChem CID | 129054357 |
| Molecular Formula | C21H25NOS |
| Molecular Weight | 339.50 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | N-[4-ethenyl-2-[(4-ethyl-2-methylphenoxy)methyl]phenyl]propanethioamide |
| SMILES | C=Cc1ccc(NC(=S)CC)c(COc2ccc(CC)cc2C)c1 |
| InChI | InChI=1S/C21H25NOS/c1-5-16-9-11-20(15(4)12-16)23-14-18-13-17(6-2)8-10-19(18)22-21(24)7-3/h6,8-13H,2,5,7,14H2,1,3-4H3,(H,22,24) |
| InChIKey | TYRWLGJKTYWDCG-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.50 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|