C20H25NO2S2 — CID 122626861
S-[2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-methylsulfanylphenyl] N-methylcarbamothioate (PubChem CID 122626861) has the molecular formula C20H25NO2S2 and a molecular weight of 375.56 g/mol. Its IUPAC name is S-[2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-methylsulfanylphenyl] N-methylcarbamothioate.
| Compound Name | S-[2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-methylsulfanylphenyl] N-methylcarbamothioate |
|---|---|
| PubChem CID | 122626861 |
| Molecular Formula | C20H25NO2S2 |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | S-[2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-methylsulfanylphenyl] N-methylcarbamothioate |
| SMILES | CCc1cc(C)c(OCc2c(SC)cccc2SC(=O)NC)cc1C |
| InChI | InChI=1S/C20H25NO2S2/c1-6-15-10-14(3)17(11-13(15)2)23-12-16-18(24-5)8-7-9-19(16)25-20(22)21-4/h7-11H,6,12H2,1-5H3,(H,21,22) |
| InChIKey | TVOXCDIILXZDGW-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|