C21H24O2S — CID 122646349
S-[3-cyclopropyl-2-[(2,4,5-trimethylphenoxy)methyl]phenyl] ethanethioate (PubChem CID 122646349) has the molecular formula C21H24O2S and a molecular weight of 340.49 g/mol. Its IUPAC name is S-[3-cyclopropyl-2-[(2,4,5-trimethylphenoxy)methyl]phenyl] ethanethioate.
| Compound Name | S-[3-cyclopropyl-2-[(2,4,5-trimethylphenoxy)methyl]phenyl] ethanethioate |
|---|---|
| PubChem CID | 122646349 |
| Molecular Formula | C21H24O2S |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | S-[3-cyclopropyl-2-[(2,4,5-trimethylphenoxy)methyl]phenyl] ethanethioate |
| SMILES | CC(=O)Sc1cccc(C2CC2)c1COc1cc(C)c(C)cc1C |
| InChI | InChI=1S/C21H24O2S/c1-13-10-15(3)20(11-14(13)2)23-12-19-18(17-8-9-17)6-5-7-21(19)24-16(4)22/h5-7,10-11,17H,8-9,12H2,1-4H3 |
| InChIKey | ANVVCQKSAGXNIL-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|