C20H23ClO3 — CID 121367617
propyl 3-chloro-2-[(2,4,5-trimethylphenoxy)methyl]benzoate (PubChem CID 121367617) has the molecular formula C20H23ClO3 and a molecular weight of 346.85 g/mol. Its IUPAC name is propyl 3-chloro-2-[(2,4,5-trimethylphenoxy)methyl]benzoate.
| Compound Name | propyl 3-chloro-2-[(2,4,5-trimethylphenoxy)methyl]benzoate |
|---|---|
| PubChem CID | 121367617 |
| Molecular Formula | C20H23ClO3 |
| Molecular Weight | 346.85 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | propyl 3-chloro-2-[(2,4,5-trimethylphenoxy)methyl]benzoate |
| SMILES | CCCOC(=O)c1cccc(Cl)c1COc1cc(C)c(C)cc1C |
| InChI | InChI=1S/C20H23ClO3/c1-5-9-23-20(22)16-7-6-8-18(21)17(16)12-24-19-11-14(3)13(2)10-15(19)4/h6-8,10-11H,5,9,12H2,1-4H3 |
| InChIKey | XIQHVRGTGGDPNS-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.85 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |