C18H21NO3 — CID 118244206
N-hydroxy-3-methyl-2-[(2,4,5-trimethylphenoxy)methyl]benzamide (PubChem CID 118244206) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is N-hydroxy-3-methyl-2-[(2,4,5-trimethylphenoxy)methyl]benzamide.
| Compound Name | N-hydroxy-3-methyl-2-[(2,4,5-trimethylphenoxy)methyl]benzamide |
|---|---|
| PubChem CID | 118244206 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | N-hydroxy-3-methyl-2-[(2,4,5-trimethylphenoxy)methyl]benzamide |
| SMILES | Cc1cc(C)c(OCc2c(C)cccc2C(=O)NO)cc1C |
| InChI | InChI=1S/C18H21NO3/c1-11-6-5-7-15(18(20)19-21)16(11)10-22-17-9-13(3)12(2)8-14(17)4/h5-9,21H,10H2,1-4H3,(H,19,20) |
| InChIKey | URTQUVXLFZUYII-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|