C19H19F3O4S — CID 144860986
[3-methoxy-2-[[5-methyl-4-sulfanyl-2-(trifluoromethyl)phenoxy]methyl]phenyl] propanoate (PubChem CID 144860986) has the molecular formula C19H19F3O4S and a molecular weight of 400.42 g/mol. Its IUPAC name is [3-methoxy-2-[[5-methyl-4-sulfanyl-2-(trifluoromethyl)phenoxy]methyl]phenyl] propanoate.
| Compound Name | [3-methoxy-2-[[5-methyl-4-sulfanyl-2-(trifluoromethyl)phenoxy]methyl]phenyl] propanoate |
|---|---|
| PubChem CID | 144860986 |
| Molecular Formula | C19H19F3O4S |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | [3-methoxy-2-[[5-methyl-4-sulfanyl-2-(trifluoromethyl)phenoxy]methyl]phenyl] propanoate |
| SMILES | CCC(=O)Oc1cccc(OC)c1COc1cc(C)c(S)cc1C(F)(F)F |
| InChI | InChI=1S/C19H19F3O4S/c1-4-18(23)26-15-7-5-6-14(24-3)12(15)10-25-16-8-11(2)17(27)9-13(16)19(20,21)22/h5-9,27H,4,10H2,1-3H3 |
| InChIKey | KAKGTKWAXLOYJJ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 44.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|