About [2-[(2,5-Dichloro-4-methylphenoxy)methyl]phenyl] methyl carbonate
[2-[(2,5-Dichloro-4-methylphenoxy)methyl]phenyl] methyl carbonate (PubChem CID 122645598) has the molecular formula C16H14Cl2O4
and a molecular weight of 341.20 g/mol. Its IUPAC name is [2-[(2,5-dichloro-4-methylphenoxy)methyl]phenyl] methyl carbonate.
Molecular Properties
| Compound Name | [2-[(2,5-Dichloro-4-methylphenoxy)methyl]phenyl] methyl carbonate |
| PubChem CID | 122645598 |
| Molecular Formula | C16H14Cl2O4 |
| Molecular Weight | 341.20 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | [2-[(2,5-dichloro-4-methylphenoxy)methyl]phenyl] methyl carbonate |
| SMILES | CC1=CC(=C(C=C1Cl)OCC2=CC=CC=C2OC(=O)OC)Cl |
| InChI | InChI=1S/C16H14Cl2O4/c1-10-7-13(18)15(8-12(10)17)21-9-11-5-3-4-6-14(11)22-16(19)20-2/h3-8H,9H2,1-2H3 |
| InChIKey | ZLCFRKYSJYDFGW-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 44.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | 366 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.20 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze [2-[(2,5-Dichloro-4-methylphenoxy)methyl]phenyl] methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2,5-Dichloro-4-methylphenoxy)methyl]phenyl] methyl carbonate?
The IUPAC name of [2-[(2,5-Dichloro-4-methylphenoxy)methyl]phenyl] methyl carbonate (CID 122645598) is [2-[(2,5-dichloro-4-methylphenoxy)methyl]phenyl] methyl carbonate.
What is the SMILES notation for [2-[(2,5-Dichloro-4-methylphenoxy)methyl]phenyl] methyl carbonate?
The canonical SMILES for [2-[(2,5-Dichloro-4-methylphenoxy)methyl]phenyl] methyl carbonate is CC1=CC(=C(C=C1Cl)OCC2=CC=CC=C2OC(=O)OC)Cl.
What is the InChIKey of [2-[(2,5-Dichloro-4-methylphenoxy)methyl]phenyl] methyl carbonate?
The InChIKey is ZLCFRKYSJYDFGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14Cl2O4/c1-10-7-13(18)15(8-12(10)17)21-9-11-5-3-4-6-14(11)22-16(19)20-2/h3-8H,9H2,1-2H3.
What are the key properties of [2-[(2,5-Dichloro-4-methylphenoxy)methyl]phenyl] methyl carbonate?
[2-[(2,5-Dichloro-4-methylphenoxy)methyl]phenyl] methyl carbonate has a molecular weight of 341.20 g/mol, XLogP of 5.20, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2,5-Dichloro-4-methylphenoxy)methyl]phenyl] methyl carbonate is sourced from PubChem (CID 122645598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).