C18H19BrO3 — CID 122646070
[2-[(2-bromo-4,5-dimethylphenoxy)methyl]phenyl] propanoate (PubChem CID 122646070) has the molecular formula C18H19BrO3 and a molecular weight of 363.25 g/mol. Its IUPAC name is [2-[(2-bromo-4,5-dimethylphenoxy)methyl]phenyl] propanoate.
| Compound Name | [2-[(2-bromo-4,5-dimethylphenoxy)methyl]phenyl] propanoate |
|---|---|
| PubChem CID | 122646070 |
| Molecular Formula | C18H19BrO3 |
| Molecular Weight | 363.25 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | [2-[(2-bromo-4,5-dimethylphenoxy)methyl]phenyl] propanoate |
| SMILES | CCC(=O)Oc1ccccc1COc1cc(C)c(C)cc1Br |
| InChI | InChI=1S/C18H19BrO3/c1-4-18(20)22-16-8-6-5-7-14(16)11-21-17-10-13(3)12(2)9-15(17)19/h5-10H,4,11H2,1-3H3 |
| InChIKey | FMXHSRPWSBYKMW-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.25 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|