C21H25NO3S — CID 126515841
S-methyl N-[2-cyclopropyl-6-[(4-ethyl-2-methylphenoxy)methyl]phenyl]-N-hydroxycarbamothioate (PubChem CID 126515841) has the molecular formula C21H25NO3S and a molecular weight of 371.50 g/mol. Its IUPAC name is S-methyl N-[2-cyclopropyl-6-[(4-ethyl-2-methylphenoxy)methyl]phenyl]-N-hydroxycarbamothioate.
| Compound Name | S-methyl N-[2-cyclopropyl-6-[(4-ethyl-2-methylphenoxy)methyl]phenyl]-N-hydroxycarbamothioate |
|---|---|
| PubChem CID | 126515841 |
| Molecular Formula | C21H25NO3S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | S-methyl N-[2-cyclopropyl-6-[(4-ethyl-2-methylphenoxy)methyl]phenyl]-N-hydroxycarbamothioate |
| SMILES | CCc1ccc(OCc2cccc(C3CC3)c2N(O)C(=O)SC)c(C)c1 |
| InChI | InChI=1S/C21H25NO3S/c1-4-15-8-11-19(14(2)12-15)25-13-17-6-5-7-18(16-9-10-16)20(17)22(24)21(23)26-3/h5-8,11-12,16,24H,4,9-10,13H2,1-3H3 |
| InChIKey | QOYFLOKXELWBFI-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|