C21H23F2NO3 — CID 126589148
difluoromethyl N-[2-cyclopropyl-6-[(4-ethyl-2-methylphenoxy)methyl]phenyl]carbamate (PubChem CID 126589148) has the molecular formula C21H23F2NO3 and a molecular weight of 375.42 g/mol. Its IUPAC name is difluoromethyl N-[2-cyclopropyl-6-[(4-ethyl-2-methylphenoxy)methyl]phenyl]carbamate.
| Compound Name | difluoromethyl N-[2-cyclopropyl-6-[(4-ethyl-2-methylphenoxy)methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 126589148 |
| Molecular Formula | C21H23F2NO3 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | difluoromethyl N-[2-cyclopropyl-6-[(4-ethyl-2-methylphenoxy)methyl]phenyl]carbamate |
| SMILES | CCc1ccc(OCc2cccc(C3CC3)c2NC(=O)OC(F)F)c(C)c1 |
| InChI | InChI=1S/C21H23F2NO3/c1-3-14-7-10-18(13(2)11-14)26-12-16-5-4-6-17(15-8-9-15)19(16)24-21(25)27-20(22)23/h4-7,10-11,15,20H,3,8-9,12H2,1-2H3,(H,24,25) |
| InChIKey | LSDNUNYETNQMLC-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |